C13H22N2O3 — CID 122562882
1-N'-[[1-(methoxymethyl)cyclopentyl]methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 122562882) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-N'-[[1-(methoxymethyl)cyclopentyl]methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[[1-(methoxymethyl)cyclopentyl]methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 122562882 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-N'-[[1-(methoxymethyl)cyclopentyl]methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COCC1(CNC(=O)C2(C(N)=O)CC2)CCCC1 |
| InChI | InChI=1S/C13H22N2O3/c1-18-9-12(4-2-3-5-12)8-15-11(17)13(6-7-13)10(14)16/h2-9H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | PTTNLXHCRXGTRI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|