C13H14F3NO3 — CID 60700981
methyl 2-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]propanoate (PubChem CID 60700981) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is methyl 2-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]propanoate.
| Compound Name | methyl 2-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 60700981 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | methyl 2-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO3/c1-8(12(19)20-2)17-11(18)7-9-3-5-10(6-4-9)13(14,15)16/h3-6,8H,7H2,1-2H3,(H,17,18) |
| InChIKey | GYKIGEVXNJHJRY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |