C28H33NO6 — CID 90352014
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-methyl-N-(4-methylphenyl)anilino)benzoic acid (PubChem CID 90352014) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-methyl-N-(4-methylphenyl)anilino)benzoic acid.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-methyl-N-(4-methylphenyl)anilino)benzoic acid |
|---|---|
| PubChem CID | 90352014 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-methyl-N-(4-methylphenyl)anilino)benzoic acid |
| SMILES | COCCOCCOCCOc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1C(=O)O |
| InChI | InChI=1S/C28H33NO6/c1-21-4-8-23(9-5-21)29(24-10-6-22(2)7-11-24)25-12-13-27(26(20-25)28(30)31)35-19-18-34-17-16-33-15-14-32-3/h4-13,20H,14-19H2,1-3H3,(H,30,31) |
| InChIKey | NCKVSIYEIDIDSV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|