C40H41NO6 — CID 90352041
ethyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate (PubChem CID 90352041) has the molecular formula C40H41NO6 and a molecular weight of 631.77 g/mol. Its IUPAC name is ethyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate.
| Compound Name | ethyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate |
|---|---|
| PubChem CID | 90352041 |
| Molecular Formula | C40H41NO6 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | ethyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5-(4-phenyl-N-(4-phenylphenyl)anilino)benzoate |
| SMILES | CCOC(=O)c1cc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)ccc1OCCOCCOCCOC |
| InChI | InChI=1S/C40H41NO6/c1-3-46-40(42)38-30-37(22-23-39(38)47-29-28-45-27-26-44-25-24-43-2)41(35-18-14-33(15-19-35)31-10-6-4-7-11-31)36-20-16-34(17-21-36)32-12-8-5-9-13-32/h4-23,30H,3,24-29H2,1-2H3 |
| InChIKey | KECLOQORHPBSFN-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|