C22H31F3N4O5 — CID 59452658
tert-butyl 4-[1-[4-nitro-3-(2,2,2-trifluoroethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 59452658) has the molecular formula C22H31F3N4O5 and a molecular weight of 488.51 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-nitro-3-(2,2,2-trifluoroethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[4-nitro-3-(2,2,2-trifluoroethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59452658 |
| Molecular Formula | C22H31F3N4O5 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | tert-butyl 4-[1-[4-nitro-3-(2,2,2-trifluoroethoxy)phenyl]piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CCN(c3ccc([N+](=O)[O-])c(OCC(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H31F3N4O5/c1-21(2,3)34-20(30)28-12-10-27(11-13-28)16-6-8-26(9-7-16)17-4-5-18(29(31)32)19(14-17)33-15-22(23,24)25/h4-5,14,16H,6-13,15H2,1-3H3 |
| InChIKey | IWVPTRHHBAXZKC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|