C25H35BFNO5 — CID 59174940
tert-butyl 6'-fluoro-5'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[azepane-4,2'-chromene]-1-carboxylate (PubChem CID 59174940) has the molecular formula C25H35BFNO5 and a molecular weight of 459.37 g/mol. Its IUPAC name is tert-butyl 6'-fluoro-5'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[azepane-4,2'-chromene]-1-carboxylate.
| Compound Name | tert-butyl 6'-fluoro-5'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[azepane-4,2'-chromene]-1-carboxylate |
|---|---|
| PubChem CID | 59174940 |
| Molecular Formula | C25H35BFNO5 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | tert-butyl 6'-fluoro-5'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[azepane-4,2'-chromene]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C=Cc3c(ccc(F)c3B3OC(C)(C)C(C)(C)O3)O2)CC1 |
| InChI | InChI=1S/C25H35BFNO5/c1-22(2,3)31-21(29)28-15-8-12-25(14-16-28)13-11-17-19(30-25)10-9-18(27)20(17)26-32-23(4,5)24(6,7)33-26/h9-11,13H,8,12,14-16H2,1-7H3 |
| InChIKey | BGHKVJYEPTWLFK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|