C19H30BrN5O5 — CID 143305467
N'-(5-bromo-2-pyridinyl)oxamide;tert-butyl carbamate;1-piperidin-1-ylethanone (PubChem CID 143305467) has the molecular formula C19H30BrN5O5 and a molecular weight of 488.38 g/mol. Its IUPAC name is N'-(5-bromo-2-pyridinyl)oxamide;tert-butyl carbamate;1-piperidin-1-ylethanone.
| Compound Name | N'-(5-bromo-2-pyridinyl)oxamide;tert-butyl carbamate;1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 143305467 |
| Molecular Formula | C19H30BrN5O5 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N'-(5-bromo-2-pyridinyl)oxamide;tert-butyl carbamate;1-piperidin-1-ylethanone |
| SMILES | CC(=O)N1CCCCC1.CC(C)(C)OC(N)=O.NC(=O)C(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C7H6BrN3O2.C7H13NO.C5H11NO2/c8-4-1-2-5(10-3-4)11-7(13)6(9)12;1-7(9)8-5-3-2-4-6-8;1-5(2,3)8-4(6)7/h1-3H,(H2,9,12)(H,10,11,13);2-6H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | BGPKBSMZLQCHAY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 157.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|