C22H34FN3O2Si — CID 44514533
tert-butyl 4-cyano-4-(4-fluoro-5-triethylsilyl-2-pyridinyl)piperidine-1-carboxylate (PubChem CID 44514533) has the molecular formula C22H34FN3O2Si and a molecular weight of 419.62 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-(4-fluoro-5-triethylsilyl-2-pyridinyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyano-4-(4-fluoro-5-triethylsilyl-2-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 44514533 |
| Molecular Formula | C22H34FN3O2Si |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl 4-cyano-4-(4-fluoro-5-triethylsilyl-2-pyridinyl)piperidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)c1cnc(C2(C#N)CCN(C(=O)OC(C)(C)C)CC2)cc1F |
| InChI | InChI=1S/C22H34FN3O2Si/c1-7-29(8-2,9-3)18-15-25-19(14-17(18)23)22(16-24)10-12-26(13-11-22)20(27)28-21(4,5)6/h14-15H,7-13H2,1-6H3 |
| InChIKey | VMIRAGJUDJAECV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|