C23H33N3O2 — CID 134432038
tert-butyl 4-(4-cyano-4-phenylcyclohexyl)-1,4-diazepane-1-carboxylate (PubChem CID 134432038) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is tert-butyl 4-(4-cyano-4-phenylcyclohexyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(4-cyano-4-phenylcyclohexyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 134432038 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | tert-butyl 4-(4-cyano-4-phenylcyclohexyl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C2CCC(C#N)(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H33N3O2/c1-22(2,3)28-21(27)26-15-7-14-25(16-17-26)20-10-12-23(18-24,13-11-20)19-8-5-4-6-9-19/h4-6,8-9,20H,7,10-17H2,1-3H3 |
| InChIKey | GRIMKUFXHAORPU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |