C21H32FNO5 — CID 166152923
tert-butyl 4-[4-[ethoxy(methoxy)methyl]-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 166152923) has the molecular formula C21H32FNO5 and a molecular weight of 397.49 g/mol. Its IUPAC name is tert-butyl 4-[4-[ethoxy(methoxy)methyl]-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[ethoxy(methoxy)methyl]-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166152923 |
| Molecular Formula | C21H32FNO5 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | tert-butyl 4-[4-[ethoxy(methoxy)methyl]-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | CCOC(OC)c1ccc(C2(F)CCN(C(=O)OC(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C21H32FNO5/c1-7-27-18(26-6)16-9-8-15(14-17(16)25-5)21(22)10-12-23(13-11-21)19(24)28-20(2,3)4/h8-9,14,18H,7,10-13H2,1-6H3 |
| InChIKey | MBVWSBUAMXRNCZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|