C33H43N3O5Si — CID 10908057
tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[2-oxo-3-(6-oxopyrimidin-1-yl)propyl]piperidine-1-carboxylate (PubChem CID 10908057) has the molecular formula C33H43N3O5Si and a molecular weight of 589.81 g/mol. Its IUPAC name is tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[2-oxo-3-(6-oxopyrimidin-1-yl)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[2-oxo-3-(6-oxopyrimidin-1-yl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10908057 |
| Molecular Formula | C33H43N3O5Si |
| Molecular Weight | 589.81 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[2-oxo-3-(6-oxopyrimidin-1-yl)propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1CC(=O)Cn1cnccc1=O |
| InChI | InChI=1S/C33H43N3O5Si/c1-32(2,3)40-31(39)36-21-13-18-29(28(36)22-25(37)23-35-24-34-20-19-30(35)38)41-42(33(4,5)6,26-14-9-7-10-15-26)27-16-11-8-12-17-27/h7-12,14-17,19-20,24,28-29H,13,18,21-23H2,1-6H3 |
| InChIKey | RSWNMRZOHKGELR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.81 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|