C23H31N3O6 — CID 25067607
tert-butyl (2S,3S)-3-(methoxymethoxy)-2-[2-oxo-3-(4-oxoquinazolin-3-yl)propyl]piperidine-1-carboxylate (PubChem CID 25067607) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-(methoxymethoxy)-2-[2-oxo-3-(4-oxoquinazolin-3-yl)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-(methoxymethoxy)-2-[2-oxo-3-(4-oxoquinazolin-3-yl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25067607 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | tert-butyl (2S,3S)-3-(methoxymethoxy)-2-[2-oxo-3-(4-oxoquinazolin-3-yl)propyl]piperidine-1-carboxylate |
| SMILES | COCO[C@H]1CCCN(C(=O)OC(C)(C)C)[C@H]1CC(=O)Cn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C23H31N3O6/c1-23(2,3)32-22(29)26-11-7-10-20(31-15-30-4)19(26)12-16(27)13-25-14-24-18-9-6-5-8-17(18)21(25)28/h5-6,8-9,14,19-20H,7,10-13,15H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | RGTZQPOLIKMXRU-PMACEKPBSA-N |
| XLogP | 2.74 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|