C24H25N3O4 — CID 10025077
3-[3-[(2S)-1-benzoyl-3-methoxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one (PubChem CID 10025077) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-[3-[(2S)-1-benzoyl-3-methoxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one.
| Compound Name | 3-[3-[(2S)-1-benzoyl-3-methoxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
|---|---|
| PubChem CID | 10025077 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 3-[3-[(2S)-1-benzoyl-3-methoxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
| SMILES | COC1CCCN(C(=O)c2ccccc2)[C@H]1CC(=O)Cn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C24H25N3O4/c1-31-22-12-7-13-27(23(29)17-8-3-2-4-9-17)21(22)14-18(28)15-26-16-25-20-11-6-5-10-19(20)24(26)30/h2-6,8-11,16,21-22H,7,12-15H2,1H3/t21-,22?/m0/s1 |
| InChIKey | NYLAZAVZIUCCKV-HMTLIYDFSA-N |
| XLogP | 2.68 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |