C26H34ClN3O5Si — CID 58482409
tert-butyl 2-[3-[6-chloro-4-oxo-7-(2-trimethylsilylethynyl)quinazolin-3-yl]-2-oxopropyl]-3-hydroxypiperidine-1-carboxylate (PubChem CID 58482409) has the molecular formula C26H34ClN3O5Si and a molecular weight of 532.11 g/mol. Its IUPAC name is tert-butyl 2-[3-[6-chloro-4-oxo-7-(2-trimethylsilylethynyl)quinazolin-3-yl]-2-oxopropyl]-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[6-chloro-4-oxo-7-(2-trimethylsilylethynyl)quinazolin-3-yl]-2-oxopropyl]-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58482409 |
| Molecular Formula | C26H34ClN3O5Si |
| Molecular Weight | 532.11 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | tert-butyl 2-[3-[6-chloro-4-oxo-7-(2-trimethylsilylethynyl)quinazolin-3-yl]-2-oxopropyl]-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)C1CC(=O)Cn1cnc2cc(C#C[Si](C)(C)C)c(Cl)cc2c1=O |
| InChI | InChI=1S/C26H34ClN3O5Si/c1-26(2,3)35-25(34)30-10-7-8-23(32)22(30)13-18(31)15-29-16-28-21-12-17(9-11-36(4,5)6)20(27)14-19(21)24(29)33/h12,14,16,22-23,32H,7-8,10,13,15H2,1-6H3 |
| InChIKey | HBZYPNLSHMSHHN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.11 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|