C19H25N3O4 — CID 71278911
tert-butyl 4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidine-1-carboxylate (PubChem CID 71278911) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71278911 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(Cn2cnc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C19H25N3O4/c1-18(2,3)26-17(24)21-10-8-19(25,9-11-21)12-22-13-20-15-7-5-4-6-14(15)16(22)23/h4-7,13,25H,8-12H2,1-3H3 |
| InChIKey | MWNASWKOHDJOPW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |