C19H25N3O5 — CID 46955302
2-methoxyethyl 2-[4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidin-1-yl]acetate (PubChem CID 46955302) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-methoxyethyl 2-[4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidin-1-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 46955302 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-methoxyethyl 2-[4-hydroxy-4-[(4-oxoquinazolin-3-yl)methyl]piperidin-1-yl]acetate |
| SMILES | COCCOC(=O)CN1CCC(O)(Cn2cnc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C19H25N3O5/c1-26-10-11-27-17(23)12-21-8-6-19(25,7-9-21)13-22-14-20-16-5-3-2-4-15(16)18(22)24/h2-5,14,25H,6-13H2,1H3 |
| InChIKey | OTZRYIYTLJEPFM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|