C22H31N3O4 — CID 166169115
tert-butyl 4-[3-(6-hydroxy-4-oxoquinazolin-3-yl)propyl]-4-methylpiperidine-1-carboxylate (PubChem CID 166169115) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl 4-[3-(6-hydroxy-4-oxoquinazolin-3-yl)propyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(6-hydroxy-4-oxoquinazolin-3-yl)propyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166169115 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | tert-butyl 4-[3-(6-hydroxy-4-oxoquinazolin-3-yl)propyl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC1(CCCn2cnc3ccc(O)cc3c2=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H31N3O4/c1-21(2,3)29-20(28)24-12-9-22(4,10-13-24)8-5-11-25-15-23-18-7-6-16(26)14-17(18)19(25)27/h6-7,14-15,26H,5,8-13H2,1-4H3 |
| InChIKey | WOCCWLKPPCOLMR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |