C11H13N3O2 — CID 117264089
6-hydroxy-3-[2-(methylamino)ethyl]quinazolin-4-one (PubChem CID 117264089) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-hydroxy-3-[2-(methylamino)ethyl]quinazolin-4-one.
| Compound Name | 6-hydroxy-3-[2-(methylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 117264089 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6-hydroxy-3-[2-(methylamino)ethyl]quinazolin-4-one |
| SMILES | CNCCn1cnc2ccc(O)cc2c1=O |
| InChI | InChI=1S/C11H13N3O2/c1-12-4-5-14-7-13-10-3-2-8(15)6-9(10)11(14)16/h2-3,6-7,12,15H,4-5H2,1H3 |
| InChIKey | OUMFCWZLIBVILI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |