C11H10N2O4 — CID 117264509
3-(7-hydroxy-4-oxoquinazolin-3-yl)propanoic acid (PubChem CID 117264509) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-(7-hydroxy-4-oxoquinazolin-3-yl)propanoic acid.
| Compound Name | 3-(7-hydroxy-4-oxoquinazolin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 117264509 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-(7-hydroxy-4-oxoquinazolin-3-yl)propanoic acid |
| SMILES | O=C(O)CCn1cnc2cc(O)ccc2c1=O |
| InChI | InChI=1S/C11H10N2O4/c14-7-1-2-8-9(5-7)12-6-13(11(8)17)4-3-10(15)16/h1-2,5-6,14H,3-4H2,(H,15,16) |
| InChIKey | TUURSMYLZPPULH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |