C20H19N3O5 — CID 4835709
3-(4-hydroxyphenyl)-2-[3-(4-oxoquinazolin-3-yl)propanoylamino]propanoic acid (PubChem CID 4835709) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-[3-(4-oxoquinazolin-3-yl)propanoylamino]propanoic acid.
| Compound Name | 3-(4-hydroxyphenyl)-2-[3-(4-oxoquinazolin-3-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 4835709 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-[3-(4-oxoquinazolin-3-yl)propanoylamino]propanoic acid |
| SMILES | O=C(CCn1cnc2ccccc2c1=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C20H19N3O5/c24-14-7-5-13(6-8-14)11-17(20(27)28)22-18(25)9-10-23-12-21-16-4-2-1-3-15(16)19(23)26/h1-8,12,17,24H,9-11H2,(H,22,25)(H,27,28) |
| InChIKey | FWTVZZJPJUJOSL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |