C35H41ClFN3O2Si — CID 172536264
6-[(3S,4R)-1-[(3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-fluoropiperidin-4-yl]-7-chloroisoquinolin-3-amine (PubChem CID 172536264) has the molecular formula C35H41ClFN3O2Si and a molecular weight of 618.27 g/mol. Its IUPAC name is 6-[(3S,4R)-1-[(3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-fluoropiperidin-4-yl]-7-chloroisoquinolin-3-amine.
| Compound Name | 6-[(3S,4R)-1-[(3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-fluoropiperidin-4-yl]-7-chloroisoquinolin-3-amine |
|---|---|
| PubChem CID | 172536264 |
| Molecular Formula | C35H41ClFN3O2Si |
| Molecular Weight | 618.27 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 6-[(3S,4R)-1-[(3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-fluoropiperidin-4-yl]-7-chloroisoquinolin-3-amine |
| SMILES | CC(C)(C)[Si](O[C@H]1COC[C@@]1(C)N1CC[C@H](c2cc3cc(N)ncc3cc2Cl)[C@H](F)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H41ClFN3O2Si/c1-34(2,3)43(26-11-7-5-8-12-26,27-13-9-6-10-14-27)42-32-22-41-23-35(32,4)40-16-15-28(31(37)21-40)29-17-24-19-33(38)39-20-25(24)18-30(29)36/h5-14,17-20,28,31-32H,15-16,21-23H2,1-4H3,(H2,38,39)/t28-,31-,32+,35-/m1/s1 |
| InChIKey | PBTVNRLJVIZLQJ-LXTXFLCWSA-N |
| XLogP | 6.33 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.27 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|