C14H19NO2 — CID 20735664
(3R,4S)-4-tert-butyl-3-phenylmethoxyazetidin-2-one (PubChem CID 20735664) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3R,4S)-4-tert-butyl-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4S)-4-tert-butyl-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 20735664 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3R,4S)-4-tert-butyl-3-phenylmethoxyazetidin-2-one |
| SMILES | CC(C)(C)[C@@H]1NC(=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-14(2,3)12-11(13(16)15-12)17-9-10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3,(H,15,16)/t11-,12-/m1/s1 |
| InChIKey | DOSNCPUYQQPTLT-VXGBXAGGSA-N |
| XLogP | 2.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |