C21H24BrNO2 — CID 102175178
(3S,4R)-1-benzyl-4-(1-bromo-2-methylpropan-2-yl)-3-phenylmethoxyazetidin-2-one (PubChem CID 102175178) has the molecular formula C21H24BrNO2 and a molecular weight of 402.33 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-(1-bromo-2-methylpropan-2-yl)-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-4-(1-bromo-2-methylpropan-2-yl)-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 102175178 |
| Molecular Formula | C21H24BrNO2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (3S,4R)-1-benzyl-4-(1-bromo-2-methylpropan-2-yl)-3-phenylmethoxyazetidin-2-one |
| SMILES | CC(C)(CBr)[C@@H]1[C@H](OCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H24BrNO2/c1-21(2,15-22)19-18(25-14-17-11-7-4-8-12-17)20(24)23(19)13-16-9-5-3-6-10-16/h3-12,18-19H,13-15H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | SPZHLKAXEMATFD-OALUTQOASA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|