C17H23Br2NO2 — CID 11697741
(3S,4R,5S)-5-bromo-4-(bromomethyl)-1-tert-butyl-4-methyl-3-phenylmethoxypyrrolidin-2-one (PubChem CID 11697741) has the molecular formula C17H23Br2NO2 and a molecular weight of 433.18 g/mol. Its IUPAC name is (3S,4R,5S)-5-bromo-4-(bromomethyl)-1-tert-butyl-4-methyl-3-phenylmethoxypyrrolidin-2-one.
| Compound Name | (3S,4R,5S)-5-bromo-4-(bromomethyl)-1-tert-butyl-4-methyl-3-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11697741 |
| Molecular Formula | C17H23Br2NO2 |
| Molecular Weight | 433.18 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | (3S,4R,5S)-5-bromo-4-(bromomethyl)-1-tert-butyl-4-methyl-3-phenylmethoxypyrrolidin-2-one |
| SMILES | CC(C)(C)N1C(=O)[C@@H](OCc2ccccc2)[C@](C)(CBr)[C@@H]1Br |
| InChI | InChI=1S/C17H23Br2NO2/c1-16(2,3)20-14(21)13(17(4,11-18)15(20)19)22-10-12-8-6-5-7-9-12/h5-9,13,15H,10-11H2,1-4H3/t13-,15-,17+/m1/s1 |
| InChIKey | XFJKKTQTLNWUIA-UNEWFSDZSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|