C20H29NO3 — CID 11771893
(1S,4S)-2-tert-butyl-1-hydroxy-4-phenylmethoxy-2-azaspiro[4.5]decan-3-one (PubChem CID 11771893) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (1S,4S)-2-tert-butyl-1-hydroxy-4-phenylmethoxy-2-azaspiro[4.5]decan-3-one.
| Compound Name | (1S,4S)-2-tert-butyl-1-hydroxy-4-phenylmethoxy-2-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11771893 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (1S,4S)-2-tert-butyl-1-hydroxy-4-phenylmethoxy-2-azaspiro[4.5]decan-3-one |
| SMILES | CC(C)(C)N1C(=O)[C@@H](OCc2ccccc2)C2(CCCCC2)[C@@H]1O |
| InChI | InChI=1S/C20H29NO3/c1-19(2,3)21-17(22)16(24-14-15-10-6-4-7-11-15)20(18(21)23)12-8-5-9-13-20/h4,6-7,10-11,16,18,23H,5,8-9,12-14H2,1-3H3/t16-,18+/m1/s1 |
| InChIKey | QZVWLFNREMISIY-AEFFLSMTSA-N |
| XLogP | 3.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |