C47H54O9Si — CID 44512548
methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate (PubChem CID 44512548) has the molecular formula C47H54O9Si and a molecular weight of 791.03 g/mol. Its IUPAC name is methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate.
| Compound Name | methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 44512548 |
| Molecular Formula | C47H54O9Si |
| Molecular Weight | 791.03 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropanoate |
| SMILES | COC(=O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[C@H]1O[C@H](CO)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H54O9Si/c1-47(2,3)57(38-26-16-8-17-27-38,39-28-18-9-19-29-39)54-34-41(45(49)50-4)56-46-44(53-33-37-24-14-7-15-25-37)43(52-32-36-22-12-6-13-23-36)42(40(30-48)55-46)51-31-35-20-10-5-11-21-35/h5-29,40-44,46,48H,30-34H2,1-4H3/t40-,41-,42-,43+,44-,46-/m1/s1 |
| InChIKey | KYNGSXWXEUKUAU-CQVCTRCBSA-N |
| XLogP | 6.59 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.03 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|