C37H40N2O3Si — CID 10929996
[(5R,6R,7S)-6,7-bis(phenylmethoxy)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10929996) has the molecular formula C37H40N2O3Si and a molecular weight of 588.82 g/mol. Its IUPAC name is [(5R,6R,7S)-6,7-bis(phenylmethoxy)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(5R,6R,7S)-6,7-bis(phenylmethoxy)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10929996 |
| Molecular Formula | C37H40N2O3Si |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | [(5R,6R,7S)-6,7-bis(phenylmethoxy)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)c2cncn21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H40N2O3Si/c1-37(2,3)43(31-20-12-6-13-21-31,32-22-14-7-15-23-32)42-27-34-36(41-26-30-18-10-5-11-19-30)35(33-24-38-28-39(33)34)40-25-29-16-8-4-9-17-29/h4-24,28,34-36H,25-27H2,1-3H3/t34-,35+,36-/m1/s1 |
| InChIKey | ARILQMKZWZKRJF-ZTJXOPACSA-N |
| XLogP | 6.86 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|