C32H41NO4Si — CID 11261102
[(3aS,6R,7R,7aR)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11261102) has the molecular formula C32H41NO4Si and a molecular weight of 531.77 g/mol. Its IUPAC name is [(3aS,6R,7R,7aR)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,6R,7R,7aR)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11261102 |
| Molecular Formula | C32H41NO4Si |
| Molecular Weight | 531.77 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | [(3aS,6R,7R,7aR)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](OCc3ccccc3)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)NC[C@@H]2O1 |
| InChI | InChI=1S/C32H41NO4Si/c1-31(2,3)38(25-17-11-7-12-18-25,26-19-13-8-14-20-26)35-23-27-29(34-22-24-15-9-6-10-16-24)30-28(21-33-27)36-32(4,5)37-30/h6-20,27-30,33H,21-23H2,1-5H3/t27-,28+,29-,30-/m1/s1 |
| InChIKey | OJWMGGJLXOMSIF-GOGZTAQTSA-N |
| XLogP | 4.64 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.77 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|