C25H34N2O3Si — CID 135018815
[(3aR,7S,7aS)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]pyridazin-7-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 135018815) has the molecular formula C25H34N2O3Si and a molecular weight of 438.64 g/mol. Its IUPAC name is [(3aR,7S,7aS)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]pyridazin-7-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,7S,7aS)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]pyridazin-7-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 135018815 |
| Molecular Formula | C25H34N2O3Si |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [(3aR,7S,7aS)-2,2,4-trimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]pyridazin-7-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1=NN[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C25H34N2O3Si/c1-18-22-23(30-25(5,6)29-22)21(27-26-18)17-28-31(24(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-23,27H,17H2,1-6H3/t21-,22+,23-/m0/s1 |
| InChIKey | HISHKECVJOXPAK-ZRBLBEILSA-N |
| XLogP | 3.43 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|