C17H25NO4 — CID 102411405
(3aR,4R,7S,7aR)-4-(methoxymethyl)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine (PubChem CID 102411405) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3aR,4R,7S,7aR)-4-(methoxymethyl)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine.
| Compound Name | (3aR,4R,7S,7aR)-4-(methoxymethyl)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 102411405 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (3aR,4R,7S,7aR)-4-(methoxymethyl)-2,2-dimethyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridine |
| SMILES | COC[C@H]1NC[C@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H25NO4/c1-17(2)21-15-13(11-19-3)18-9-14(16(15)22-17)20-10-12-7-5-4-6-8-12/h4-8,13-16,18H,9-11H2,1-3H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | JANWYOWAKJUPHN-QKPAOTATSA-N |
| XLogP | 1.71 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |