C35H42F3NO4 — CID 155286524
[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidin-2-yl]methanol (PubChem CID 155286524) has the molecular formula C35H42F3NO4 and a molecular weight of 597.72 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidin-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 155286524 |
| Molecular Formula | C35H42F3NO4 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-[[4-(trifluoromethyl)cyclohexyl]methyl]piperidin-2-yl]methanol |
| SMILES | OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1CC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C35H42F3NO4/c36-35(37,38)30-18-16-26(17-19-30)20-39-21-32(41-23-27-10-4-1-5-11-27)34(43-25-29-14-8-3-9-15-29)33(31(39)22-40)42-24-28-12-6-2-7-13-28/h1-15,26,30-34,40H,16-25H2/t26?,30?,31-,32+,33-,34-/m1/s1 |
| InChIKey | YOUBKWYTQUNZCZ-ASMAPMDSSA-N |
| XLogP | 6.79 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |