C14H19F2NO4 — CID 157039442
(2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 157039442) has the molecular formula C14H19F2NO4 and a molecular weight of 303.31 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039442 |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-(2,3-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCc1cccc(F)c1F |
| InChI | InChI=1S/C14H19F2NO4/c15-9-3-1-2-8(12(9)16)4-5-17-6-11(19)14(21)13(20)10(17)7-18/h1-3,10-11,13-14,18-21H,4-7H2/t10-,11+,13-,14-/m1/s1 |
| InChIKey | HXOVGMQXCNJWSP-ZMJPVWNMSA-N |
| XLogP | -0.73 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |