C16H20O5 — CID 174970929
3-phenylmethoxy-2-propylcyclobutane-1,1-dicarboxylic acid (PubChem CID 174970929) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-phenylmethoxy-2-propylcyclobutane-1,1-dicarboxylic acid.
| Compound Name | 3-phenylmethoxy-2-propylcyclobutane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 174970929 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-phenylmethoxy-2-propylcyclobutane-1,1-dicarboxylic acid |
| SMILES | CCCC1C(OCc2ccccc2)CC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H20O5/c1-2-6-12-13(9-16(12,14(17)18)15(19)20)21-10-11-7-4-3-5-8-11/h3-5,7-8,12-13H,2,6,9-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | QSJSXJABOXZDTE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|