C43H43NO4 — CID 101249026
(2S,3S,4R,5R,6S)-1-benzyl-2-ethynyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine (PubChem CID 101249026) has the molecular formula C43H43NO4 and a molecular weight of 637.82 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-1-benzyl-2-ethynyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine.
| Compound Name | (2S,3S,4R,5R,6S)-1-benzyl-2-ethynyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 101249026 |
| Molecular Formula | C43H43NO4 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | (2S,3S,4R,5R,6S)-1-benzyl-2-ethynyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine |
| SMILES | C#C[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C43H43NO4/c1-2-39-41(46-30-36-22-12-5-13-23-36)43(48-32-38-26-16-7-17-27-38)42(47-31-37-24-14-6-15-25-37)40(33-45-29-35-20-10-4-11-21-35)44(39)28-34-18-8-3-9-19-34/h1,3-27,39-43H,28-33H2/t39-,40-,41-,42+,43+/m0/s1 |
| InChIKey | YHGWBANDXKKHMQ-IVBRNKFMSA-N |
| XLogP | 7.85 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|