C45H49NO5 — CID 101412904
4-[(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]butanal (PubChem CID 101412904) has the molecular formula C45H49NO5 and a molecular weight of 683.89 g/mol. Its IUPAC name is 4-[(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]butanal.
| Compound Name | 4-[(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]butanal |
|---|---|
| PubChem CID | 101412904 |
| Molecular Formula | C45H49NO5 |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | 4-[(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]butanal |
| SMILES | O=CCCC[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C45H49NO5/c47-29-17-16-28-41-43(49-32-38-22-10-3-11-23-38)45(51-34-40-26-14-5-15-27-40)44(50-33-39-24-12-4-13-25-39)42(35-48-31-37-20-8-2-9-21-37)46(41)30-36-18-6-1-7-19-36/h1-15,18-27,29,41-45H,16-17,28,30-35H2/t41-,42-,43+,44-,45-/m1/s1 |
| InChIKey | KTGKWMATDTUKTA-XVQIYQHQSA-N |
| XLogP | 8.58 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|