C28H33NO7 — CID 10720040
1-O-benzyl 2-O-ethyl (2S,3S,4R)-4-(3-butoxybenzoyl)-3-(2-oxoethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 10720040) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2S,3S,4R)-4-(3-butoxybenzoyl)-3-(2-oxoethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2S,3S,4R)-4-(3-butoxybenzoyl)-3-(2-oxoethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10720040 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2S,3S,4R)-4-(3-butoxybenzoyl)-3-(2-oxoethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCOc1cccc(C(=O)[C@H]2CN(C(=O)OCc3ccccc3)[C@H](C(=O)OCC)[C@H]2CC=O)c1 |
| InChI | InChI=1S/C28H33NO7/c1-3-5-16-35-22-13-9-12-21(17-22)26(31)24-18-29(25(23(24)14-15-30)27(32)34-4-2)28(33)36-19-20-10-7-6-8-11-20/h6-13,15,17,23-25H,3-5,14,16,18-19H2,1-2H3/t23-,24-,25-/m0/s1 |
| InChIKey | SQXLYFRHMCZDGG-SDHOMARFSA-N |
| XLogP | 4.45 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|