C37H43NO7 — CID 10675273
1-O-benzyl 2-O-ethyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 10675273) has the molecular formula C37H43NO7 and a molecular weight of 613.75 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10675273 |
| Molecular Formula | C37H43NO7 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2S,3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C(c1ccc(OCCCCCc2ccccc2)cc1)[C@H]1CN(C(=O)OCc2ccccc2)[C@H](C(=O)OCC)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C37H43NO7/c1-4-43-36(40)35-32(24-34(39)42-3)33(25-38(35)37(41)45-26-29-17-10-6-11-18-29)27(2)30-19-21-31(22-20-30)44-23-13-7-12-16-28-14-8-5-9-15-28/h5-6,8-11,14-15,17-22,32-33,35H,2,4,7,12-13,16,23-26H2,1,3H3/t32-,33+,35-/m0/s1 |
| InChIKey | ZJCNZGYUAVCNIR-UJNSZXMOSA-N |
| XLogP | 6.87 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|