C26H28ClNO6 — CID 10600960
1-O-benzyl 2-O-ethyl (2S,3S,4S)-4-[1-(4-chlorophenyl)ethenyl]-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 10600960) has the molecular formula C26H28ClNO6 and a molecular weight of 485.96 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2S,3S,4S)-4-[1-(4-chlorophenyl)ethenyl]-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2S,3S,4S)-4-[1-(4-chlorophenyl)ethenyl]-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10600960 |
| Molecular Formula | C26H28ClNO6 |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2S,3S,4S)-4-[1-(4-chlorophenyl)ethenyl]-3-(2-methoxy-2-oxoethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C(c1ccc(Cl)cc1)[C@H]1CN(C(=O)OCc2ccccc2)[C@H](C(=O)OCC)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C26H28ClNO6/c1-4-33-25(30)24-21(14-23(29)32-3)22(17(2)19-10-12-20(27)13-11-19)15-28(24)26(31)34-16-18-8-6-5-7-9-18/h5-13,21-22,24H,2,4,14-16H2,1,3H3/t21-,22+,24-/m0/s1 |
| InChIKey | DQRGIIWELDBCSQ-ZDXQCDESSA-N |
| XLogP | 4.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|