C30H37NO5 — CID 10743708
2-O-benzyl 3-O-ethyl (3S,3aS,6aS)-6-(3-methyl-4-pentoxyphenyl)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 10743708) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-O-benzyl 3-O-ethyl (3S,3aS,6aS)-6-(3-methyl-4-pentoxyphenyl)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aS)-6-(3-methyl-4-pentoxyphenyl)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10743708 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aS)-6-(3-methyl-4-pentoxyphenyl)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CCCCCOc1ccc(C2=CC[C@H]3[C@@H]2CN(C(=O)OCc2ccccc2)[C@@H]3C(=O)OCC)cc1C |
| InChI | InChI=1S/C30H37NO5/c1-4-6-10-17-35-27-16-13-23(18-21(27)3)24-14-15-25-26(24)19-31(28(25)29(32)34-5-2)30(33)36-20-22-11-8-7-9-12-22/h7-9,11-14,16,18,25-26,28H,4-6,10,15,17,19-20H2,1-3H3/t25-,26+,28-/m0/s1 |
| InChIKey | LBKGKNCGCWQQCO-REUBFRLUSA-N |
| XLogP | 6.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|