C25H29NO5 — CID 10669971
2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(3-methylphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 10669971) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(3-methylphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(3-methylphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10669971 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(3-methylphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCC(O)(c3cccc(C)c3)[C@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29NO5/c1-3-30-23(27)22-20-12-13-25(29,19-11-7-8-17(2)14-19)21(20)15-26(22)24(28)31-16-18-9-5-4-6-10-18/h4-11,14,20-22,29H,3,12-13,15-16H2,1-2H3/t20-,21-,22-,25?/m0/s1 |
| InChIKey | CWVTVQQYPZYXTA-QYGYTYJESA-N |
| XLogP | 3.79 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |