C30H31NO6 — CID 10815278
2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(4-phenoxyphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 10815278) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(4-phenoxyphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(4-phenoxyphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10815278 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-(4-phenoxyphenyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCC(O)(c3ccc(Oc4ccccc4)cc3)[C@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H31NO6/c1-2-35-28(32)27-25-17-18-30(34,22-13-15-24(16-14-22)37-23-11-7-4-8-12-23)26(25)19-31(27)29(33)36-20-21-9-5-3-6-10-21/h3-16,25-27,34H,2,17-20H2,1H3/t25-,26-,27-,30?/m0/s1 |
| InChIKey | JVDOZUJMWZVNDS-GTXHPKBLSA-N |
| XLogP | 5.28 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |