C24H25NO5Se — CID 59519803
2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-oxo-5-phenylselanyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 59519803) has the molecular formula C24H25NO5Se and a molecular weight of 486.43 g/mol. Its IUPAC name is 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-oxo-5-phenylselanyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-oxo-5-phenylselanyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 59519803 |
| Molecular Formula | C24H25NO5Se |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-oxo-5-phenylselanyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CC([Se]c3ccccc3)C(=O)[C@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H25NO5Se/c1-2-29-23(27)21-18-13-20(31-17-11-7-4-8-12-17)22(26)19(18)14-25(21)24(28)30-15-16-9-5-3-6-10-16/h3-12,18-21H,2,13-15H2,1H3/t18-,19-,20?,21-/m0/s1 |
| InChIKey | VRKFVYFODUWBKK-GEMXJRIASA-N |
| XLogP | 2.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|