C33H37NO6 — CID 10674076
2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-[3-methyl-4-(2-phenylethoxy)phenyl]-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 10674076) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-[3-methyl-4-(2-phenylethoxy)phenyl]-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-[3-methyl-4-(2-phenylethoxy)phenyl]-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10674076 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 2-O-benzyl 3-O-ethyl (3S,3aS,6aR)-6-hydroxy-6-[3-methyl-4-(2-phenylethoxy)phenyl]-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCC(O)(c3ccc(OCCc4ccccc4)c(C)c3)[C@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H37NO6/c1-3-38-31(35)30-27-16-18-33(37,28(27)21-34(30)32(36)40-22-25-12-8-5-9-13-25)26-14-15-29(23(2)20-26)39-19-17-24-10-6-4-7-11-24/h4-15,20,27-28,30,37H,3,16-19,21-22H2,1-2H3/t27-,28-,30-,33?/m0/s1 |
| InChIKey | PZMWZOPRGXUTQZ-IWLKTLJZSA-N |
| XLogP | 5.41 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |