C18H17ClN2O — CID 162207315
3-chloro-5-phenyl-1-propyl-3H-1,4-benzodiazepin-2-one (PubChem CID 162207315) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is 3-chloro-5-phenyl-1-propyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 3-chloro-5-phenyl-1-propyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 162207315 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-chloro-5-phenyl-1-propyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CCCN1C(=O)C(Cl)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H17ClN2O/c1-2-12-21-15-11-7-6-10-14(15)16(20-17(19)18(21)22)13-8-4-3-5-9-13/h3-11,17H,2,12H2,1H3 |
| InChIKey | OXJNIQQKXYMIFT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|