C16H13N5O — CID 45358547
3-azido-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 45358547) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-azido-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 3-azido-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 45358547 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-azido-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)C(N=[N+]=[N-])N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C16H13N5O/c1-21-13-10-6-5-9-12(13)14(11-7-3-2-4-8-11)18-15(16(21)22)19-20-17/h2-10,15H,1H3 |
| InChIKey | MJJAYQKHDBKHAT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|