About 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane
3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane (PubChem CID 160733178) has the molecular formula C22H27N5O2
and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane.
Molecular Properties
| Compound Name | 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane |
| PubChem CID | 160733178 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane |
| SMILES | CCN=C=O.CN(C)CCN1C(=O)C(N)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H22N4O.C3H5NO/c1-22(2)12-13-23-16-11-7-6-10-15(16)17(21-18(20)19(23)24)14-8-4-3-5-9-14;1-2-4-3-5/h3-11,18H,12-13,20H2,1-2H3;2H2,1H3 |
| InChIKey | RUPMFOJIJFGUMT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane?
The IUPAC name of 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane (CID 160733178) is 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane.
What is the SMILES notation for 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane?
The canonical SMILES for 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane is CCN=C=O.CN(C)CCN1C(=O)C(N)N=C(c2ccccc2)c2ccccc21.
What is the InChIKey of 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane?
The InChIKey is RUPMFOJIJFGUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O.C3H5NO/c1-22(2)12-13-23-16-11-7-6-10-15(16)17(21-18(20)19(23)24)14-8-4-3-5-9-14;1-2-4-3-5/h3-11,18H,12-13,20H2,1-2H3;2H2,1H3.
What are the key properties of 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane?
3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane has a molecular weight of 393.49 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[2-(dimethylamino)ethyl]-5-phenyl-3H-1,4-benzodiazepin-2-one;isocyanatoethane is sourced from PubChem (CID 160733178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).