C26H22F3N5O2 — CID 88945544
benzyl N-[2-methylidene-5-phenyl-1-(2,2,2-trifluoroethanehydrazonoyl)-3H-1,4-benzodiazepin-3-yl]carbamate (PubChem CID 88945544) has the molecular formula C26H22F3N5O2 and a molecular weight of 493.49 g/mol. Its IUPAC name is benzyl N-[2-methylidene-5-phenyl-1-(2,2,2-trifluoroethanehydrazonoyl)-3H-1,4-benzodiazepin-3-yl]carbamate.
| Compound Name | benzyl N-[2-methylidene-5-phenyl-1-(2,2,2-trifluoroethanehydrazonoyl)-3H-1,4-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 88945544 |
| Molecular Formula | C26H22F3N5O2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | benzyl N-[2-methylidene-5-phenyl-1-(2,2,2-trifluoroethanehydrazonoyl)-3H-1,4-benzodiazepin-3-yl]carbamate |
| SMILES | C=C1C(NC(=O)OCc2ccccc2)N=C(c2ccccc2)c2ccccc2N1/C(=N\N)C(F)(F)F |
| InChI | InChI=1S/C26H22F3N5O2/c1-17-23(32-25(35)36-16-18-10-4-2-5-11-18)31-22(19-12-6-3-7-13-19)20-14-8-9-15-21(20)34(17)24(33-30)26(27,28)29/h2-15,23H,1,16,30H2,(H,32,35)/b33-24- |
| InChIKey | FEUCNVVTVBRRKL-GIBOGKFOSA-N |
| XLogP | 4.94 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|