C29H31N5O2 — CID 88945522
benzyl N-[1-(2,2-dimethylpropanehydrazonoyl)-2-methylidene-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate (PubChem CID 88945522) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is benzyl N-[1-(2,2-dimethylpropanehydrazonoyl)-2-methylidene-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate.
| Compound Name | benzyl N-[1-(2,2-dimethylpropanehydrazonoyl)-2-methylidene-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 88945522 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | benzyl N-[1-(2,2-dimethylpropanehydrazonoyl)-2-methylidene-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate |
| SMILES | C=C1C(NC(=O)OCc2ccccc2)N=C(c2ccccc2)c2ccccc2N1/C(=N\N)C(C)(C)C |
| InChI | InChI=1S/C29H31N5O2/c1-20-26(32-28(35)36-19-21-13-7-5-8-14-21)31-25(22-15-9-6-10-16-22)23-17-11-12-18-24(23)34(20)27(33-30)29(2,3)4/h5-18,26H,1,19,30H2,2-4H3,(H,32,35)/b33-27- |
| InChIKey | BMLJTRUSUKHUTB-KGGMANCPSA-N |
| XLogP | 5.43 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|