C33H29N3O3 — CID 134349602
(2S)-2-[benzyl(formyl)amino]-3-(1-tritylimidazol-4-yl)propanoic acid (PubChem CID 134349602) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is (2S)-2-[benzyl(formyl)amino]-3-(1-tritylimidazol-4-yl)propanoic acid.
| Compound Name | (2S)-2-[benzyl(formyl)amino]-3-(1-tritylimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 134349602 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (2S)-2-[benzyl(formyl)amino]-3-(1-tritylimidazol-4-yl)propanoic acid |
| SMILES | O=CN(Cc1ccccc1)[C@@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)O |
| InChI | InChI=1S/C33H29N3O3/c37-25-35(22-26-13-5-1-6-14-26)31(32(38)39)21-30-23-36(24-34-30)33(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20,23-25,31H,21-22H2,(H,38,39)/t31-/m0/s1 |
| InChIKey | LDNRFBXXGAPANC-HKBQPEDESA-N |
| XLogP | 5.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|