C47H55N4O2P — CID 139329091
N-benzyl-N-[4-cyano-3-oxo-4-(tributyl-λ5-phosphanylidene)-1-(1-tritylimidazol-4-yl)butan-2-yl]formamide (PubChem CID 139329091) has the molecular formula C47H55N4O2P and a molecular weight of 738.96 g/mol. Its IUPAC name is N-benzyl-N-[4-cyano-3-oxo-4-(tributyl-λ5-phosphanylidene)-1-(1-tritylimidazol-4-yl)butan-2-yl]formamide.
| Compound Name | N-benzyl-N-[4-cyano-3-oxo-4-(tributyl-λ5-phosphanylidene)-1-(1-tritylimidazol-4-yl)butan-2-yl]formamide |
|---|---|
| PubChem CID | 139329091 |
| Molecular Formula | C47H55N4O2P |
| Molecular Weight | 738.96 g/mol |
| Exact Mass | 738.41 |
| IUPAC Name | N-benzyl-N-[4-cyano-3-oxo-4-(tributyl-λ5-phosphanylidene)-1-(1-tritylimidazol-4-yl)butan-2-yl]formamide |
| SMILES | CCCCP(CCCC)(CCCC)=C(C#N)C(=O)C(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)N(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C47H55N4O2P/c1-4-7-30-54(31-8-5-2,32-9-6-3)45(34-48)46(53)44(50(38-52)35-39-22-14-10-15-23-39)33-43-36-51(37-49-43)47(40-24-16-11-17-25-40,41-26-18-12-19-27-41)42-28-20-13-21-29-42/h10-29,36-38,44H,4-9,30-33,35H2,1-3H3 |
| InChIKey | MRUMAGHAODKUBW-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.96 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|